CAS 2217-65-4 appears in our catalog under these names: 2,2'–Oxybis(nitrobenzene), 2,2'-Oxybis(nitrobenzene) 95%, 2,2'-Oxybis(nitrobenzene), 95%, 95%, 2,2'-Oxybis(nitrobenzene), 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g.
1-nitro-2-(2-nitrophenoxy)benzene (CAS 2217-65-4) is a chemical compound with the molecular formula C12H8N2O5 and a molecular weight of 260.20 g/mol. IUPAC name: 1-nitro-2-(2-nitrophenoxy)benzene. InChIKey: XVIRIXVOLLJIPF-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O5 |
|---|---|
| Molecular weight | 260.20 g/mol |
| IUPAC name | 1-nitro-2-(2-nitrophenoxy)benzene |
| InChIKey | XVIRIXVOLLJIPF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])OC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)