Products 1184966-71-9
CAS 1184966-71-9 is the registry number for Methaqualone-d5 (tolyl-alpha,alpha,alpha,4,6-d5), 98 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,01g.
3-[3,5-dideuterio-2-(trideuteriomethyl)phenyl]-2-methylquinazolin-4-one (CAS 1184966-71-9) is a chemical compound with the molecular formula C16H14N2O and a molecular weight of 255.32 g/mol. IUPAC name: 3-[3,5-dideuterio-2-(trideuteriomethyl)phenyl]-2-methylquinazolin-4-one. InChIKey: JEYCTXHKTXCGPB-XUYCAUAGSA-N.
| Molecular formula | C16H14N2O |
|---|---|
| Molecular weight | 255.32 g/mol |
| IUPAC name | 3-[3,5-dideuterio-2-(trideuteriomethyl)phenyl]-2-methylquinazolin-4-one |
| InChIKey | JEYCTXHKTXCGPB-XUYCAUAGSA-N |
| SMILES | [2H]C1=CC(=C(C(=C1)N2C(=NC3=CC=CC=C3C2=O)C)C([2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)