CAS 1184988-39-3 appears in our catalog under these names: N-(4-Amino-2-methylphenyl)butanamide hydrochloride, 95%, N-(4-Amino-2-methylphenyl)butanamide hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
N-(4-amino-2-methylphenyl)butanamide;hydrochloride (CAS 1184988-39-3) is a chemical compound with the molecular formula C11H17ClN2O and a molecular weight of 228.72 g/mol. IUPAC name: N-(4-amino-2-methylphenyl)butanamide;hydrochloride. InChIKey: VLJQWFGEWVHOMY-UHFFFAOYSA-N.
| Molecular formula | C11H17ClN2O |
|---|---|
| Molecular weight | 228.72 g/mol |
| IUPAC name | N-(4-amino-2-methylphenyl)butanamide;hydrochloride |
| InChIKey | VLJQWFGEWVHOMY-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC1=C(C=C(C=C1)N)C.Cl |
Computed by PubChem (NCBI)