CAS 1184994-08-8 is the registry number for 3,3-Dimethyl-1-(1H-pyrazol-1-yl)butan-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3,3-dimethyl-1-pyrazol-1-ylbutan-2-amine;hydrochloride (CAS 1184994-08-8) is a chemical compound with the molecular formula C9H18ClN3 and a molecular weight of 203.71 g/mol. IUPAC name: 3,3-dimethyl-1-pyrazol-1-ylbutan-2-amine;hydrochloride. InChIKey: UBSREWNABWZTKU-UHFFFAOYSA-N.
| Molecular formula | C9H18ClN3 |
|---|---|
| Molecular weight | 203.71 g/mol |
| IUPAC name | 3,3-dimethyl-1-pyrazol-1-ylbutan-2-amine;hydrochloride |
| InChIKey | UBSREWNABWZTKU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(CN1C=CC=N1)N.Cl |
Computed by PubChem (NCBI)