CAS 1559063-98-7 is the registry number for [(1-Isopropyl-3,5-dimethyl-1h-pyrazol-4-yl)methyl]amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
(3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methanamine;hydrochloride (CAS 1559063-98-7) is a chemical compound with the molecular formula C9H18ClN3 and a molecular weight of 203.71 g/mol. IUPAC name: (3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methanamine;hydrochloride. InChIKey: NTGFYPPMXIGGHR-UHFFFAOYSA-N.
| Molecular formula | C9H18ClN3 |
|---|---|
| Molecular weight | 203.71 g/mol |
| IUPAC name | (3,5-dimethyl-1-propan-2-ylpyrazol-4-yl)methanamine;hydrochloride |
| InChIKey | NTGFYPPMXIGGHR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C(C)C)C)CN.Cl |
Computed by PubChem (NCBI)