CAS 1375474-63-7 appears in our catalog under these names: 2,2-Dimethyl-1-(1-methyl-1H-pyrazol-4-yl)propan-1-amine hydrochloride, 95%, 2,2-Dimethyl-1-(1-methyl-1H-pyrazol-4-yl)propan-1-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,2-dimethyl-1-(1-methylpyrazol-4-yl)propan-1-amine;hydrochloride (CAS 1375474-63-7) is a chemical compound with the molecular formula C9H18ClN3 and a molecular weight of 203.71 g/mol. IUPAC name: 2,2-dimethyl-1-(1-methylpyrazol-4-yl)propan-1-amine;hydrochloride. InChIKey: WBKKNONBJPHWMT-UHFFFAOYSA-N.
| Molecular formula | C9H18ClN3 |
|---|---|
| Molecular weight | 203.71 g/mol |
| IUPAC name | 2,2-dimethyl-1-(1-methylpyrazol-4-yl)propan-1-amine;hydrochloride |
| InChIKey | WBKKNONBJPHWMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CN(N=C1)C)N.Cl |
Computed by PubChem (NCBI)