Products 1184998-16-0
CAS 1184998-16-0 appears in our catalog under these names: Tolmetin-d3, >95% (HPLC), Tolmetin–d3, Tolmetin-d3. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2-[5-(4-methylbenzoyl)-1-(trideuteriomethyl)pyrrol-2-yl]acetic acid (CAS 1184998-16-0) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 260.30 g/mol. IUPAC name: 2-[5-(4-methylbenzoyl)-1-(trideuteriomethyl)pyrrol-2-yl]acetic acid. InChIKey: UPSPUYADGBWSHF-BMSJAHLVSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 260.30 g/mol |
| IUPAC name | 2-[5-(4-methylbenzoyl)-1-(trideuteriomethyl)pyrrol-2-yl]acetic acid |
| InChIKey | UPSPUYADGBWSHF-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])N1C(=CC=C1C(=O)C2=CC=C(C=C2)C)CC(=O)O |
Computed by PubChem (NCBI)