CAS 1185020-84-1 is the registry number for Benzyl 4–(Bromophenyl)–ether–d4. Offered by: GLPBio. Available pack sizes: 10mg.
1-bromo-2,3,5,6-tetradeuterio-4-phenylmethoxybenzene (CAS 1185020-84-1) is a chemical compound with the molecular formula C13H11BrO and a molecular weight of 267.15 g/mol. IUPAC name: 1-bromo-2,3,5,6-tetradeuterio-4-phenylmethoxybenzene. InChIKey: OUQSGILAXUXMGI-YKVCKAMESA-N.
| Molecular formula | C13H11BrO |
|---|---|
| Molecular weight | 267.15 g/mol |
| IUPAC name | 1-bromo-2,3,5,6-tetradeuterio-4-phenylmethoxybenzene |
| InChIKey | OUQSGILAXUXMGI-YKVCKAMESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1OCC2=CC=CC=C2)[2H])[2H])Br)[2H] |
Computed by PubChem (NCBI)