Products 1185025-41-5
CAS 1185025-41-5 appears in our catalog under these names: Carbamazepine 10,11-Epoxide-d2 (Major), >95% (HPLC), Carbamazepine 10,11 epoxide-d2. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2,4-dideuterio-3-oxa-11-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene-11-carboxamide (CAS 1185025-41-5) is a chemical compound with the molecular formula C15H12N2O2 and a molecular weight of 254.28 g/mol. IUPAC name: 2,4-dideuterio-3-oxa-11-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene-11-carboxamide. InChIKey: ZRWWEEVEIOGMMT-FLZZRPEZSA-N.
| Molecular formula | C15H12N2O2 |
|---|---|
| Molecular weight | 254.28 g/mol |
| IUPAC name | 2,4-dideuterio-3-oxa-11-azatetracyclo[10.4.0.02,4.05,10]hexadeca-1(16),5,7,9,12,14-hexaene-11-carboxamide |
| InChIKey | ZRWWEEVEIOGMMT-FLZZRPEZSA-N |
| SMILES | [2H]C12C3=CC=CC=C3N(C4=CC=CC=C4C1(O2)[2H])C(=O)N |
Computed by PubChem (NCBI)