CAS 1185039-70-6 is the registry number for 4-(N-(Methyl-d3)-N-nitrosamino)-4-(3-pyridyl)butanal. Offered by: TRC. Available pack sizes: 10mg, 1mg.
N-(4-oxo-1-pyridin-3-ylbutyl)-N-(trideuteriomethyl)nitrous amide (CAS 1185039-70-6) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 210.25 g/mol. IUPAC name: N-(4-oxo-1-pyridin-3-ylbutyl)-N-(trideuteriomethyl)nitrous amide. InChIKey: FRJHUNPWTKLYGL-FIBGUPNXSA-N.
| Molecular formula | C10H13N3O2 |
|---|---|
| Molecular weight | 210.25 g/mol |
| IUPAC name | N-(4-oxo-1-pyridin-3-ylbutyl)-N-(trideuteriomethyl)nitrous amide |
| InChIKey | FRJHUNPWTKLYGL-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(C(CCC=O)C1=CN=CC=C1)N=O |
Computed by PubChem (NCBI)