Products 64091-90-3

CAS 64091-90-3 is the registry number for 4-(N-Methyl-N-nitrosamino)-4-(3-pyridyl)butanal. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 5mg.

Structural formula: {0} (CAS {1})

N-methyl-N-(4-oxo-1-pyridin-3-ylbutyl)nitrous amide (CAS 64091-90-3) is a chemical compound with the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. IUPAC name: N-methyl-N-(4-oxo-1-pyridin-3-ylbutyl)nitrous amide. InChIKey: FRJHUNPWTKLYGL-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13N3O2
Molecular weight207.23 g/mol
IUPAC nameN-methyl-N-(4-oxo-1-pyridin-3-ylbutyl)nitrous amide
InChIKeyFRJHUNPWTKLYGL-UHFFFAOYSA-N
SMILESCN(C(CCC=O)C1=CN=CC=C1)N=O

Computed by PubChem (NCBI)