CAS 1185047-08-8 is the registry number for 2,3-Dichlorobenzamidyl Guanidine-13C2. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
2,3-dichloro-N-(diamino(113C)methylideneamino)(13C2)benzamide (CAS 1185047-08-8) is a chemical compound with the molecular formula C8H8Cl2N4O and a molecular weight of 249.06 g/mol. IUPAC name: 2,3-dichloro-N-(diamino(113C)methylideneamino)(13C2)benzamide. InChIKey: VCPDTPYRBILFCT-BFGUONQLSA-N.
| Molecular formula | C8H8Cl2N4O |
|---|---|
| Molecular weight | 249.06 g/mol |
| IUPAC name | 2,3-dichloro-N-(diamino(113C)methylideneamino)(13C2)benzamide |
| InChIKey | VCPDTPYRBILFCT-BFGUONQLSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)[13C](=O)NN=[13C](N)N |
Computed by PubChem (NCBI)