CAS 1630906-96-5 is the registry number for 5,7-Dichloro-2-(2-methoxyethyl)-2h-pyrazolo[4,3-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g.
5,7-dichloro-2-(2-methoxyethyl)pyrazolo[4,3-d]pyrimidine (CAS 1630906-96-5) is a chemical compound with the molecular formula C8H8Cl2N4O and a molecular weight of 247.08 g/mol. IUPAC name: 5,7-dichloro-2-(2-methoxyethyl)pyrazolo[4,3-d]pyrimidine. InChIKey: ZMUFOSSHRVESLG-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N4O |
|---|---|
| Molecular weight | 247.08 g/mol |
| IUPAC name | 5,7-dichloro-2-(2-methoxyethyl)pyrazolo[4,3-d]pyrimidine |
| InChIKey | ZMUFOSSHRVESLG-UHFFFAOYSA-N |
| SMILES | COCCN1C=C2C(=N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)