CAS 1382981-71-6 appears in our catalog under these names: 2-(2,6-Dichloro-9H-purin-8-yl)propan-2-ol, 95%, 2-(2,6-Dichloro-9H-purin-8-yl)propan-2-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2,6-dichloro-7H-purin-8-yl)propan-2-ol (CAS 1382981-71-6) is a chemical compound with the molecular formula C8H8Cl2N4O and a molecular weight of 247.08 g/mol. IUPAC name: 2-(2,6-dichloro-7H-purin-8-yl)propan-2-ol. InChIKey: APQFJZPUVYVAQC-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl2N4O |
|---|---|
| Molecular weight | 247.08 g/mol |
| IUPAC name | 2-(2,6-dichloro-7H-purin-8-yl)propan-2-ol |
| InChIKey | APQFJZPUVYVAQC-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=NC2=C(N1)C(=NC(=N2)Cl)Cl)O |
Computed by PubChem (NCBI)