CAS 1185048-67-2 is the registry number for Resorcinol-1,2,3-13C3. Offered by: TRC. Available pack sizes: 0,5mg, 5mg.
(1,2,3-13C3)cyclohexa-1,3,5-triene-1,3-diol (CAS 1185048-67-2) is a chemical compound with the molecular formula C6H6O2 and a molecular weight of 113.09 g/mol. IUPAC name: (1,2,3-13C3)cyclohexa-1,3,5-triene-1,3-diol. InChIKey: GHMLBKRAJCXXBS-VMGGCIAMSA-N.
| Molecular formula | C6H6O2 |
|---|---|
| Molecular weight | 113.09 g/mol |
| IUPAC name | (1,2,3-13C3)cyclohexa-1,3,5-triene-1,3-diol |
| InChIKey | GHMLBKRAJCXXBS-VMGGCIAMSA-N |
| SMILES | C1=C[13C](=[13CH][13C](=C1)O)O |
Computed by PubChem (NCBI)