CAS 953390-31-3 is the registry number for Resorcinol-13C6, >95% (GC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-diol (CAS 953390-31-3) is a chemical compound with the molecular formula C6H6O2 and a molecular weight of 116.067 g/mol. IUPAC name: (1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-diol. InChIKey: GHMLBKRAJCXXBS-IDEBNGHGSA-N.
| Molecular formula | C6H6O2 |
|---|---|
| Molecular weight | 116.067 g/mol |
| IUPAC name | (1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1,3-diol |
| InChIKey | GHMLBKRAJCXXBS-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13CH][13C](=[13CH]1)O)O |
Computed by PubChem (NCBI)