CAS 70938-00-0 appears in our catalog under these names: 1,3-Dihydroxybenzene-d6, 98 atom % D, min 98% Chemical Purity, 1,3–Benzene–2,4,5,6–d4–diol–d2. Offered by: CDN, GLPBio. Available pack sizes: 1g, 0,5g, 10mg.
1,2,3,5-tetradeuterio-4,6-dideuteriooxybenzene (CAS 70938-00-0) is a chemical compound with the molecular formula C6H6O2 and a molecular weight of 116.15 g/mol. IUPAC name: 1,2,3,5-tetradeuterio-4,6-dideuteriooxybenzene. InChIKey: GHMLBKRAJCXXBS-UDDMDDBKSA-N.
| Molecular formula | C6H6O2 |
|---|---|
| Molecular weight | 116.15 g/mol |
| IUPAC name | 1,2,3,5-tetradeuterio-4,6-dideuteriooxybenzene |
| InChIKey | GHMLBKRAJCXXBS-UDDMDDBKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])O[2H])[2H])O[2H])[2H] |
Computed by PubChem (NCBI)