Products 1185063-39-1
CAS 1185063-39-1 is the registry number for 4-(4-Chlorophenyl)-1-imidazol-1-yl-(butan-d5)-2-ol. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
4-(4-chlorophenyl)-1,1,2,3,3-pentadeuterio-1-imidazol-1-ylbutan-2-ol (CAS 1185063-39-1) is a chemical compound with the molecular formula C13H15ClN2O and a molecular weight of 255.75 g/mol. IUPAC name: 4-(4-chlorophenyl)-1,1,2,3,3-pentadeuterio-1-imidazol-1-ylbutan-2-ol. InChIKey: YAHZVMVZBIMHGM-OMSVOULWSA-N.
| Molecular formula | C13H15ClN2O |
|---|---|
| Molecular weight | 255.75 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-1,1,2,3,3-pentadeuterio-1-imidazol-1-ylbutan-2-ol |
| InChIKey | YAHZVMVZBIMHGM-OMSVOULWSA-N |
| SMILES | [2H]C([2H])(CC1=CC=C(C=C1)Cl)C([2H])(C([2H])([2H])N2C=CN=C2)O |
Computed by PubChem (NCBI)