Products 1185072-18-7
CAS 1185072-18-7 appears in our catalog under these names: Meclofenamic Acid-d4, >95% (HPLC), Meclofenamic acid-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg, 10 mg.
2,3,4,5-tetradeuterio-6-(2,6-dichloro-3-methylanilino)benzoic acid (CAS 1185072-18-7) is a chemical compound with the molecular formula C14H11Cl2NO2 and a molecular weight of 300.2 g/mol. IUPAC name: 2,3,4,5-tetradeuterio-6-(2,6-dichloro-3-methylanilino)benzoic acid. InChIKey: SBDNJUWAMKYJOX-QFFDRWTDSA-N.
| Molecular formula | C14H11Cl2NO2 |
|---|---|
| Molecular weight | 300.2 g/mol |
| IUPAC name | 2,3,4,5-tetradeuterio-6-(2,6-dichloro-3-methylanilino)benzoic acid |
| InChIKey | SBDNJUWAMKYJOX-QFFDRWTDSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)O)NC2=C(C=CC(=C2Cl)C)Cl)[2H])[2H] |
Computed by PubChem (NCBI)