CAS 1185076-41-8 appears in our catalog under these names: Clotrimazole-d5, Clotrimazole-d5, >95% (HPLC), Clotrimazole-d5 (phenyl-d5), 99 atom % D, min 98% Chemical Purity, Clotrimazole–d5, Clotrimazole-d5, 99.47%. Offered by: Chemat Brand, Hubei YoungXin, TRC, CDN, GLPBio. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2,5mg.
1-[(2-chlorophenyl)-(2,3,4,5,6-pentadeuteriophenyl)-phenylmethyl]imidazole (CAS 1185076-41-8) is a chemical compound with the molecular formula C22H17ClN2 and a molecular weight of 349.9 g/mol. IUPAC name: 1-[(2-chlorophenyl)-(2,3,4,5,6-pentadeuteriophenyl)-phenylmethyl]imidazole. InChIKey: VNFPBHJOKIVQEB-MBRJKSRSSA-N.
| Molecular formula | C22H17ClN2 |
|---|---|
| Molecular weight | 349.9 g/mol |
| IUPAC name | 1-[(2-chlorophenyl)-(2,3,4,5,6-pentadeuteriophenyl)-phenylmethyl]imidazole |
| InChIKey | VNFPBHJOKIVQEB-MBRJKSRSSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(C2=CC=CC=C2)(C3=CC=CC=C3Cl)N4C=CN=C4)[2H])[2H] |
Computed by PubChem (NCBI)