CAS 23593-76-2 is the registry number for Clotrimazole Impurity 13. Offered by: Chemat Brand. Available pack sizes: on request.
1-[(3-chlorophenyl)-diphenylmethyl]imidazole (CAS 23593-76-2) is a chemical compound with the molecular formula C22H17ClN2 and a molecular weight of 344.8 g/mol. IUPAC name: 1-[(3-chlorophenyl)-diphenylmethyl]imidazole. InChIKey: QGCQRZWXVPJNLV-UHFFFAOYSA-N.
| Molecular formula | C22H17ClN2 |
|---|---|
| Molecular weight | 344.8 g/mol |
| IUPAC name | 1-[(3-chlorophenyl)-diphenylmethyl]imidazole |
| InChIKey | QGCQRZWXVPJNLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC(=CC=C3)Cl)N4C=CN=C4 |
Computed by PubChem (NCBI)