CAS 60628-98-0 appears in our catalog under these names: Lombazole, Lombazole-d9. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 250mg, 100mg, 50mg, Get quote.
1-[(2-chlorophenyl)-(4-phenylphenyl)methyl]imidazole (CAS 60628-98-0) is a chemical compound with the molecular formula C22H17ClN2 and a molecular weight of 344.8 g/mol. IUPAC name: 1-[(2-chlorophenyl)-(4-phenylphenyl)methyl]imidazole. InChIKey: DALSNPRWUFOYDT-UHFFFAOYSA-N.
| Molecular formula | C22H17ClN2 |
|---|---|
| Molecular weight | 344.8 g/mol |
| IUPAC name | 1-[(2-chlorophenyl)-(4-phenylphenyl)methyl]imidazole |
| InChIKey | DALSNPRWUFOYDT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(C3=CC=CC=C3Cl)N4C=CN=C4 |
Computed by PubChem (NCBI)