CAS 1185090-82-7 is the registry number for 1-(2-Methoxyphenyl)piperazine-d8 Hydrochloride. Offered by: TRC. Available pack sizes: 100mg.
2,2,3,3,5,5,6,6-octadeuterio-1-(2-methoxyphenyl)piperazine;hydrochloride (CAS 1185090-82-7) is a chemical compound with the molecular formula C11H17ClN2O and a molecular weight of 236.77 g/mol. IUPAC name: 2,2,3,3,5,5,6,6-octadeuterio-1-(2-methoxyphenyl)piperazine;hydrochloride. InChIKey: DDMVHGULHRJOEC-OEVGSOSGSA-N.
| Molecular formula | C11H17ClN2O |
|---|---|
| Molecular weight | 236.77 g/mol |
| IUPAC name | 2,2,3,3,5,5,6,6-octadeuterio-1-(2-methoxyphenyl)piperazine;hydrochloride |
| InChIKey | DDMVHGULHRJOEC-OEVGSOSGSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=CC=CC=C2OC)([2H])[2H])[2H].Cl |
Computed by PubChem (NCBI)