Products 1381928-46-6
CAS 1381928-46-6 is the registry number for (R)-2-(4,5-Dichloro-2-fluorophenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(4,5-dichloro-2-fluorophenyl)pyrrolidine (CAS 1381928-46-6) is a chemical compound with the molecular formula C10H10Cl2FN and a molecular weight of 234.09 g/mol. IUPAC name: (2R)-2-(4,5-dichloro-2-fluorophenyl)pyrrolidine. InChIKey: PJIQQBLUBRMPPJ-SNVBAGLBSA-N.
| Molecular formula | C10H10Cl2FN |
|---|---|
| Molecular weight | 234.09 g/mol |
| IUPAC name | (2R)-2-(4,5-dichloro-2-fluorophenyl)pyrrolidine |
| InChIKey | PJIQQBLUBRMPPJ-SNVBAGLBSA-N |
| SMILES | C1C[C@@H](NC1)C2=CC(=C(C=C2F)Cl)Cl |
Computed by PubChem (NCBI)