Products 1185108-16-0
CAS 1185108-16-0 is the registry number for Glutaric Acid-1,5-13C2, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 25mg.
(1,5-13C2)pentanedioic acid (CAS 1185108-16-0) is a chemical compound with the molecular formula C5H8O4 and a molecular weight of 134.10 g/mol. IUPAC name: (1,5-13C2)pentanedioic acid. InChIKey: JFCQEDHGNNZCLN-MQIHXRCWSA-N.
| Molecular formula | C5H8O4 |
|---|---|
| Molecular weight | 134.10 g/mol |
| IUPAC name | (1,5-13C2)pentanedioic acid |
| InChIKey | JFCQEDHGNNZCLN-MQIHXRCWSA-N |
| SMILES | C(C[13C](=O)O)C[13C](=O)O |
Computed by PubChem (NCBI)