Products 19136-99-3
CAS 19136-99-3 appears in our catalog under these names: Glutaric-d4 Acid, Pentanedioic-2,2,4,4-d4 Acid, 98 atom % D, min 98% Chemical Purity, Glutaric acid–d4, Glutaric acid-d4, 99.46%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 500mg, 50mg, 1g, 0,5g, 25 mg, 50 mg, 100 mg.
2,2,4,4-tetradeuteriopentanedioic acid (CAS 19136-99-3) is a chemical compound with the molecular formula C5H8O4 and a molecular weight of 136.14 g/mol. IUPAC name: 2,2,4,4-tetradeuteriopentanedioic acid. InChIKey: JFCQEDHGNNZCLN-RRVWJQJTSA-N.
| Molecular formula | C5H8O4 |
|---|---|
| Molecular weight | 136.14 g/mol |
| IUPAC name | 2,2,4,4-tetradeuteriopentanedioic acid |
| InChIKey | JFCQEDHGNNZCLN-RRVWJQJTSA-N |
| SMILES | [2H]C([2H])(CC([2H])([2H])C(=O)O)C(=O)O |
Computed by PubChem (NCBI)