Products 154184-99-3
CAS 154184-99-3 appears in our catalog under these names: Pentanedioic-d6 Acid, >95% (HPLC), Pentanedioic-d6 Acid, 98 atom % D, min 98% Chemical Purity, Glutaric acid–d6, Glutaric acid-d6, 98.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, 50mg, 1g, 0,5g, 25mg, 5 mg, 10 mg.
2,2,3,3,4,4-hexadeuteriopentanedioic acid (CAS 154184-99-3) is a chemical compound with the molecular formula C5H8O4 and a molecular weight of 138.15 g/mol. IUPAC name: 2,2,3,3,4,4-hexadeuteriopentanedioic acid. InChIKey: JFCQEDHGNNZCLN-NMFSSPJFSA-N.
| Molecular formula | C5H8O4 |
|---|---|
| Molecular weight | 138.15 g/mol |
| IUPAC name | 2,2,3,3,4,4-hexadeuteriopentanedioic acid |
| InChIKey | JFCQEDHGNNZCLN-NMFSSPJFSA-N |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])([2H])C(=O)O |
Computed by PubChem (NCBI)