CAS 1185157-36-1 is the registry number for 2-((Ethylamino)methyl)-4-nitrophenol-d5. Offered by: TRC. Available pack sizes: 100mg, 10mg.
4-nitro-2-[(1,1,2,2,2-pentadeuterioethylamino)methyl]phenol (CAS 1185157-36-1) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 201.23 g/mol. IUPAC name: 4-nitro-2-[(1,1,2,2,2-pentadeuterioethylamino)methyl]phenol. InChIKey: BXQBOFZTTUXRNK-ZBJDZAJPSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 201.23 g/mol |
| IUPAC name | 4-nitro-2-[(1,1,2,2,2-pentadeuterioethylamino)methyl]phenol |
| InChIKey | BXQBOFZTTUXRNK-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NCC1=C(C=CC(=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)