CAS 1185174-82-6 is the registry number for 2-(2-Chlorophenyl)Morpholine Oxalate, 95%. Offered by: AmBeed. Available pack sizes: 250mg.
2-(2-chlorophenyl)morpholine;oxalic acid (CAS 1185174-82-6) is a chemical compound with the molecular formula C12H14ClNO5 and a molecular weight of 287.69 g/mol. IUPAC name: 2-(2-chlorophenyl)morpholine;oxalic acid. InChIKey: DVKWCLUMELMKMI-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO5 |
|---|---|
| Molecular weight | 287.69 g/mol |
| IUPAC name | 2-(2-chlorophenyl)morpholine;oxalic acid |
| InChIKey | DVKWCLUMELMKMI-UHFFFAOYSA-N |
| SMILES | C1COC(CN1)C2=CC=CC=C2Cl.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)