Products 285138-76-3

CAS 285138-76-3 is the registry number for Methyl 2-(2-chloroacetamido)-4,5-dimethoxybenzoate. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg, 10000mg.

Structural formula: {0} (CAS {1})

Methyl 2-[(2-chloroacetyl)amino]-4,5-dimethoxybenzoate (CAS 285138-76-3) is a chemical compound with the molecular formula C12H14ClNO5 and a molecular weight of 287.69 g/mol. IUPAC name: methyl 2-[(2-chloroacetyl)amino]-4,5-dimethoxybenzoate. InChIKey: SRNHCPUGVKCQNI-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14ClNO5
Molecular weight287.69 g/mol
IUPAC namemethyl 2-[(2-chloroacetyl)amino]-4,5-dimethoxybenzoate
InChIKeySRNHCPUGVKCQNI-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)C(=O)OC)NC(=O)CCl)OC

Computed by PubChem (NCBI)