CAS 285138-76-3 is the registry number for Methyl 2-(2-chloroacetamido)-4,5-dimethoxybenzoate. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg, 10000mg.
Methyl 2-[(2-chloroacetyl)amino]-4,5-dimethoxybenzoate (CAS 285138-76-3) is a chemical compound with the molecular formula C12H14ClNO5 and a molecular weight of 287.69 g/mol. IUPAC name: methyl 2-[(2-chloroacetyl)amino]-4,5-dimethoxybenzoate. InChIKey: SRNHCPUGVKCQNI-UHFFFAOYSA-N.
| Molecular formula | C12H14ClNO5 |
|---|---|
| Molecular weight | 287.69 g/mol |
| IUPAC name | methyl 2-[(2-chloroacetyl)amino]-4,5-dimethoxybenzoate |
| InChIKey | SRNHCPUGVKCQNI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)OC)NC(=O)CCl)OC |
Computed by PubChem (NCBI)