CAS 1185179-33-2 appears in our catalog under these names: Acyclovir-d4, Acyclovir-d4, >95% (HPLC), Acyclovir–d4, Acyclovir-d4, 98.66%. Offered by: Chemat Brand, TRC, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg, 10 mg, 5 mg.
2-amino-9-[(1,1,2,2-tetradeuterio-2-hydroxyethoxy)methyl]-1H-purin-6-one (CAS 1185179-33-2) is a chemical compound with the molecular formula C8H11N5O3 and a molecular weight of 229.23 g/mol. IUPAC name: 2-amino-9-[(1,1,2,2-tetradeuterio-2-hydroxyethoxy)methyl]-1H-purin-6-one. InChIKey: MKUXAQIIEYXACX-LNLMKGTHSA-N.
| Molecular formula | C8H11N5O3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 2-amino-9-[(1,1,2,2-tetradeuterio-2-hydroxyethoxy)methyl]-1H-purin-6-one |
| InChIKey | MKUXAQIIEYXACX-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OCN1C=NC2=C1N=C(NC2=O)N)O |
Computed by PubChem (NCBI)