Products 1538359-40-8
CAS 1538359-40-8 is the registry number for 2-(1H-1,2,3,4-Tetrazole-5-amido)cyclopentane-1-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(2H-tetrazole-5-carbonylamino)cyclopentane-1-carboxylic acid (CAS 1538359-40-8) is a chemical compound with the molecular formula C8H11N5O3 and a molecular weight of 225.20 g/mol. IUPAC name: 2-(2H-tetrazole-5-carbonylamino)cyclopentane-1-carboxylic acid. InChIKey: OFZHUHPOFSGOCH-UHFFFAOYSA-N.
| Molecular formula | C8H11N5O3 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | 2-(2H-tetrazole-5-carbonylamino)cyclopentane-1-carboxylic acid |
| InChIKey | OFZHUHPOFSGOCH-UHFFFAOYSA-N |
| SMILES | C1CC(C(C1)NC(=O)C2=NNN=N2)C(=O)O |
Computed by PubChem (NCBI)