Products 141294-79-3

CAS 141294-79-3 is the registry number for Acyclovir-side chain-2-3h, 95%. Offered by: Combi-blocks. Available pack sizes: 100g, 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2-amino-9-[(2-hydroxy-2-tritioethoxy)methyl]-1H-purin-6-one (CAS 141294-79-3) is a chemical compound with the molecular formula C8H11N5O3 and a molecular weight of 227.21 g/mol. IUPAC name: 2-amino-9-[(2-hydroxy-2-tritioethoxy)methyl]-1H-purin-6-one. InChIKey: MKUXAQIIEYXACX-CNRUNOGKSA-N.

Identity
Molecular formulaC8H11N5O3
Molecular weight227.21 g/mol
IUPAC name2-amino-9-[(2-hydroxy-2-tritioethoxy)methyl]-1H-purin-6-one
InChIKeyMKUXAQIIEYXACX-CNRUNOGKSA-N
SMILES[3H]C(COCN1C=NC2=C1N=C(NC2=O)N)O

Computed by PubChem (NCBI)