Products 1185189-97-2
CAS 1185189-97-2 appears in our catalog under these names: R–PSOP, R-PSOP, 99%, 99%, R-PSOP, 99.41%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 1mg, 25 mg, 10mM/1mL, 50 mg, 10 mg.
1-phenyl-3-[(3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-yl]urea (CAS 1185189-97-2) is a chemical compound with the molecular formula C20H22N4O2 and a molecular weight of 350.4 g/mol. IUPAC name: 1-phenyl-3-[(3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-yl]urea. InChIKey: BUOWEYLLAFLKCW-FQEVSTJZSA-N.
| Molecular formula | C20H22N4O2 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 1-phenyl-3-[(3R)-spiro[1-azabicyclo[2.2.2]octane-3,2'-3H-furo[2,3-b]pyridine]-5'-yl]urea |
| InChIKey | BUOWEYLLAFLKCW-FQEVSTJZSA-N |
| SMILES | C1CN2CCC1[C@@]3(C2)CC4=C(O3)N=CC(=C4)NC(=O)NC5=CC=CC=C5 |
Computed by PubChem (NCBI)
Synonyms:
R-PSOP, orb1688828