CAS 796888-12-5 appears in our catalog under these names: LCH–7749944, LCH-7749944/ 99.28% (existing batch purity), LCH-7749944, N2-(3-Methoxyphenyl)-N4-((tetrahydrofuran-2-yl)methyl)quinazoline-2,4-diamine, 99%, 99%, LCH-7749944, 99.68%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
2-N-(3-methoxyphenyl)-4-N-(oxolan-2-ylmethyl)quinazoline-2,4-diamine (CAS 796888-12-5) is a chemical compound with the molecular formula C20H22N4O2 and a molecular weight of 350.4 g/mol. IUPAC name: 2-N-(3-methoxyphenyl)-4-N-(oxolan-2-ylmethyl)quinazoline-2,4-diamine. InChIKey: FBWZAFQEOKNGQL-UHFFFAOYSA-N.
| Molecular formula | C20H22N4O2 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 2-N-(3-methoxyphenyl)-4-N-(oxolan-2-ylmethyl)quinazoline-2,4-diamine |
| InChIKey | FBWZAFQEOKNGQL-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)NC2=NC3=CC=CC=C3C(=N2)NCC4CCCO4 |
Computed by PubChem (NCBI)