Products 2763368-89-2

CAS 2763368-89-2 is the registry number for HDAC-IN-27, 98.12%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 10 mg, 100 mg, 50 mg.

Structural formula: {0} (CAS {1})

N-[[4-(propylaminocarbamoyl)phenyl]methyl]-1H-indole-2-carboxamide (CAS 2763368-89-2) is a chemical compound with the molecular formula C20H22N4O2 and a molecular weight of 350.4 g/mol. IUPAC name: N-[[4-(propylaminocarbamoyl)phenyl]methyl]-1H-indole-2-carboxamide. InChIKey: XGCLYPPRQZTIBB-UHFFFAOYSA-N.

Identity
Molecular formulaC20H22N4O2
Molecular weight350.4 g/mol
IUPAC nameN-[[4-(propylaminocarbamoyl)phenyl]methyl]-1H-indole-2-carboxamide
InChIKeyXGCLYPPRQZTIBB-UHFFFAOYSA-N
SMILESCCCNNC(=O)C1=CC=C(C=C1)CNC(=O)C2=CC3=CC=CC=C3N2

Computed by PubChem (NCBI)

Synonyms: orb1688829