Products 1185235-75-9
CAS 1185235-75-9 is the registry number for Para Red-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 50 mg, 5 mg.
1-[(2,3,5,6-tetradeuterio-4-nitrophenyl)diazenyl]naphthalen-2-ol (CAS 1185235-75-9) is a chemical compound with the molecular formula C16H11N3O3 and a molecular weight of 297.30 g/mol. IUPAC name: 1-[(2,3,5,6-tetradeuterio-4-nitrophenyl)diazenyl]naphthalen-2-ol. InChIKey: WOTPFVNWMLFMFW-YKVCKAMESA-N.
| Molecular formula | C16H11N3O3 |
|---|---|
| Molecular weight | 297.30 g/mol |
| IUPAC name | 1-[(2,3,5,6-tetradeuterio-4-nitrophenyl)diazenyl]naphthalen-2-ol |
| InChIKey | WOTPFVNWMLFMFW-YKVCKAMESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N=NC2=C(C=CC3=CC=CC=C32)O)[2H])[2H])[N+](=O)[O-])[2H] |
Computed by PubChem (NCBI)