Products 298193-75-6
CAS 298193-75-6 is the registry number for N-(2-Nitrophenyl)quinoline-2-carboxamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
N-(2-nitrophenyl)quinoline-2-carboxamide (CAS 298193-75-6) is a chemical compound with the molecular formula C16H11N3O3 and a molecular weight of 293.28 g/mol. IUPAC name: N-(2-nitrophenyl)quinoline-2-carboxamide. InChIKey: DHDGLTJOCMHBJD-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O3 |
|---|---|
| Molecular weight | 293.28 g/mol |
| IUPAC name | N-(2-nitrophenyl)quinoline-2-carboxamide |
| InChIKey | DHDGLTJOCMHBJD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C(=O)NC3=CC=CC=C3[N+](=O)[O-] |
Computed by PubChem (NCBI)