Products 2755712-12-8
CAS 2755712-12-8 appears in our catalog under these names: Mab Aspartate Decarboxylase-IN-1, 98%, Mab Aspartate Decarboxylase-IN-1, Mab Aspartate Decarboxylase–IN–1, 3-[(1-Naphthalenylcarbonyl)amino]-2-pyrazinecarboxylic acid, 95%, 95%, Mab Aspartate Decarboxylase-IN-1, 99.85%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 2mg, 50mg, 100mg, 10mg, 25mg, 250mg, 50 mg.
3-(naphthalene-1-carbonylamino)pyrazine-2-carboxylic acid (CAS 2755712-12-8) is a chemical compound with the molecular formula C16H11N3O3 and a molecular weight of 293.28 g/mol. IUPAC name: 3-(naphthalene-1-carbonylamino)pyrazine-2-carboxylic acid. InChIKey: LYCKJICKYNNXMU-UHFFFAOYSA-N.
| Molecular formula | C16H11N3O3 |
|---|---|
| Molecular weight | 293.28 g/mol |
| IUPAC name | 3-(naphthalene-1-carbonylamino)pyrazine-2-carboxylic acid |
| InChIKey | LYCKJICKYNNXMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C(=O)NC3=NC=CN=C3C(=O)O |
Computed by PubChem (NCBI)