CAS 1185237-13-1 is the registry number for Etretinate-d3. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 10 mg, 1 mg.
Ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-[2,3,6-trimethyl-4-(trideuteriomethoxy)phenyl]nona-2,4,6,8-tetraenoate (CAS 1185237-13-1) is a chemical compound with the molecular formula C23H30O3 and a molecular weight of 357.5 g/mol. IUPAC name: ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-[2,3,6-trimethyl-4-(trideuteriomethoxy)phenyl]nona-2,4,6,8-tetraenoate. InChIKey: HQMNCQVAMBCHCO-ISBRFZOISA-N.
| Molecular formula | C23H30O3 |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | ethyl (2E,4E,6E,8E)-3,7-dimethyl-9-[2,3,6-trimethyl-4-(trideuteriomethoxy)phenyl]nona-2,4,6,8-tetraenoate |
| InChIKey | HQMNCQVAMBCHCO-ISBRFZOISA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C(=C(C(=C1)C)/C=C/C(=C/C=C/C(=C/C(=O)OCC)/C)/C)C)C |
Computed by PubChem (NCBI)