CAS 1313382-25-0 appears in our catalog under these names: Estradiol Valerate EP Impurity G (6-Dehydro Estradiol 17-Valerate), Estradiol valerate EP Impurity G, Estradiol Valerate Impurity 7 (Estradiol Valerate EP Impurity G), 6-Dehydro Estradiol 17-Valerate. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
[(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate (CAS 1313382-25-0) is a chemical compound with the molecular formula C23H30O3 and a molecular weight of 354.5 g/mol. IUPAC name: [(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate. InChIKey: QTAQSALQAZZFHY-RBRWEJTLSA-N.
| Molecular formula | C23H30O3 |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | [(8R,9S,13S,14S,17S)-3-hydroxy-13-methyl-8,9,11,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| InChIKey | QTAQSALQAZZFHY-RBRWEJTLSA-N |
| SMILES | CCCCC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C=CC4=C3C=CC(=C4)O)C |
Computed by PubChem (NCBI)