CAS 95959-20-9 appears in our catalog under these names: ESTRADIOL-9-ENE VALERATE, Estradiol Valerate EP Impurity C, Estradiol Valerate Impurity 3 (Estradiol Valerate EP Impurity C), ∆9,11-Dehydro-17beta-estradiol 17-Valerate, >95% (HPLC), 3-Hydroxyestra-1,3,5(10),9(11)-tetraen-17beta-yl Pentanoate (9,11-Didehydroestradiol Valerate). Offered by: Sigma-Aldrich, Chemat Brand, Hubei YoungXin, TRC, Mikromol. Available pack sizes: 25MG, on request, 10mg, 50mg, 100mg, 200mg, 2,5mg, 2mg.
[(8S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate (CAS 95959-20-9) is a chemical compound with the molecular formula C23H30O3 and a molecular weight of 354.5 g/mol. IUPAC name: [(8S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate. InChIKey: JBBVWVSEQQRIJR-FBPBVXOASA-N.
| Molecular formula | C23H30O3 |
|---|---|
| Molecular weight | 354.5 g/mol |
| IUPAC name | [(8S,13S,14S,17S)-3-hydroxy-13-methyl-6,7,8,12,14,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] pentanoate |
| InChIKey | JBBVWVSEQQRIJR-FBPBVXOASA-N |
| SMILES | CCCCC(=O)O[C@H]1CC[C@@H]2[C@@]1(CC=C3[C@H]2CCC4=C3C=CC(=C4)O)C |
Computed by PubChem (NCBI)