Products 1185239-44-4
CAS 1185239-44-4 is the registry number for 3-(3-Pyridinyl)-1-(4-pyridinyl)-2-propene-1-one-d4. Offered by: TRC. Available pack sizes: 25mg.
(E)-1-pyridin-4-yl-3-(2,4,5,6-tetradeuterio-3-pyridinyl)prop-2-en-1-one (CAS 1185239-44-4) is a chemical compound with the molecular formula C13H10N2O and a molecular weight of 214.26 g/mol. IUPAC name: (E)-1-pyridin-4-yl-3-(2,4,5,6-tetradeuterio-3-pyridinyl)prop-2-en-1-one. InChIKey: UOWGYMNWMDNSTL-GWHRRPHYSA-N.
| Molecular formula | C13H10N2O |
|---|---|
| Molecular weight | 214.26 g/mol |
| IUPAC name | (E)-1-pyridin-4-yl-3-(2,4,5,6-tetradeuterio-3-pyridinyl)prop-2-en-1-one |
| InChIKey | UOWGYMNWMDNSTL-GWHRRPHYSA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])/C=C/C(=O)C2=CC=NC=C2)[2H] |
Computed by PubChem (NCBI)