CAS 1185295-18-4 is the registry number for Ethyl 5-oxo-5h-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate;hydrochloride (CAS 1185295-18-4) is a chemical compound with the molecular formula C9H9ClN2O3S and a molecular weight of 260.70 g/mol. IUPAC name: ethyl 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate;hydrochloride. InChIKey: JHPMDNVLECWGDG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O3S |
|---|---|
| Molecular weight | 260.70 g/mol |
| IUPAC name | ethyl 5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate;hydrochloride |
| InChIKey | JHPMDNVLECWGDG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN=C2N(C1=O)C=CS2.Cl |
Computed by PubChem (NCBI)