CAS 1803612-26-1 appears in our catalog under these names: 1-((2-Chloro-5-nitrophenyl)sulfanyl)-N,N-dimethylformamide, 95%, 1-((2-Chloro-5-nitrophenyl)sulfanyl)-N,N-dimethylformamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
S-(2-chloro-5-nitrophenyl) N,N-dimethylcarbamothioate (CAS 1803612-26-1) is a chemical compound with the molecular formula C9H9ClN2O3S and a molecular weight of 260.70 g/mol. IUPAC name: S-(2-chloro-5-nitrophenyl) N,N-dimethylcarbamothioate. InChIKey: CVHAQCTZCITUBH-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN2O3S |
|---|---|
| Molecular weight | 260.70 g/mol |
| IUPAC name | S-(2-chloro-5-nitrophenyl) N,N-dimethylcarbamothioate |
| InChIKey | CVHAQCTZCITUBH-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)SC1=C(C=CC(=C1)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)