Products 1309671-79-1

CAS 1309671-79-1 is the registry number for 5-(3,4-Dimethyl-1h-pyrazol-5-yl)-2-furansulfonyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

5-(4,5-dimethyl-1H-pyrazol-3-yl)furan-2-sulfonyl chloride (CAS 1309671-79-1) is a chemical compound with the molecular formula C9H9ClN2O3S and a molecular weight of 260.70 g/mol. IUPAC name: 5-(4,5-dimethyl-1H-pyrazol-3-yl)furan-2-sulfonyl chloride. InChIKey: ZEPDBIOWIYLFTH-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClN2O3S
Molecular weight260.70 g/mol
IUPAC name5-(4,5-dimethyl-1H-pyrazol-3-yl)furan-2-sulfonyl chloride
InChIKeyZEPDBIOWIYLFTH-UHFFFAOYSA-N
SMILESCC1=C(NN=C1C2=CC=C(O2)S(=O)(=O)Cl)C

Computed by PubChem (NCBI)