Products 1185296-79-0

CAS 1185296-79-0 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5-acetamidobenzoic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid (CAS 1185296-79-0) is a chemical compound with the molecular formula C24H20N2O5 and a molecular weight of 416.4 g/mol. IUPAC name: 5-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid. InChIKey: FVLXPSCVGYITQG-UHFFFAOYSA-N.

Identity
Molecular formulaC24H20N2O5
Molecular weight416.4 g/mol
IUPAC name5-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)benzoic acid
InChIKeyFVLXPSCVGYITQG-UHFFFAOYSA-N
SMILESCC(=O)NC1=CC(=C(C=C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O

Computed by PubChem (NCBI)