Products 2861994-92-3
CAS 2861994-92-3 appears in our catalog under these names: eIF4A i28, eIF4A3-IN-4, 99.8%. Offered by: TargetMol, MedChemExpress. Available pack sizes: 10mg, 10 mg.
2-[5-(4-butylphenyl)furan-2-yl]-6-nitroquinoline-4-carboxylic acid (CAS 2861994-92-3) is a chemical compound with the molecular formula C24H20N2O5 and a molecular weight of 416.4 g/mol. IUPAC name: 2-[5-(4-butylphenyl)furan-2-yl]-6-nitroquinoline-4-carboxylic acid. InChIKey: UDCAKLDMNJRQKW-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O5 |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | 2-[5-(4-butylphenyl)furan-2-yl]-6-nitroquinoline-4-carboxylic acid |
| InChIKey | UDCAKLDMNJRQKW-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)C2=CC=C(O2)C3=NC4=C(C=C(C=C4)[N+](=O)[O-])C(=C3)C(=O)O |
Computed by PubChem (NCBI)