Products 1393350-27-0
CAS 1393350-27-0 appears in our catalog under these names: DBCO–NHS ester 3, DBCO-NHS ester 3 98%, 2,5-Dioxo-1-pyrrolidinyl 11,12-didehydro-δ-oxodibenz[b,f]azocine-5(6H)-pentanoate, 98%, 98%, DBCO-NHS ester 3, 96.06%. Offered by: GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 250mg, 500mg, 50mg, 1g, 50 mg, 250 mg, 100 mg.
(2,5-dioxopyrrolidin-1-yl) 5-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-5-oxopentanoate (CAS 1393350-27-0) is a chemical compound with the molecular formula C24H20N2O5 and a molecular weight of 416.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 5-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-5-oxopentanoate. InChIKey: CFQHVJJWCDJMLI-UHFFFAOYSA-N.
| Molecular formula | C24H20N2O5 |
|---|---|
| Molecular weight | 416.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 5-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-5-oxopentanoate |
| InChIKey | CFQHVJJWCDJMLI-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42 |
Computed by PubChem (NCBI)