CAS 1185300-28-0 appears in our catalog under these names: (2,2,7-Trimethyl-3,4-dihydro-2h-chromen-4-yl)amine hydrochloride, 97%, 2,2,7-Trimethylchroman-4-amine hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 2,5g.
2,2,7-trimethyl-3,4-dihydrochromen-4-amine;hydrochloride (CAS 1185300-28-0) is a chemical compound with the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. IUPAC name: 2,2,7-trimethyl-3,4-dihydrochromen-4-amine;hydrochloride. InChIKey: LKWTZLIPPKWQEF-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO |
|---|---|
| Molecular weight | 227.73 g/mol |
| IUPAC name | 2,2,7-trimethyl-3,4-dihydrochromen-4-amine;hydrochloride |
| InChIKey | LKWTZLIPPKWQEF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(CC(O2)(C)C)N.Cl |
Computed by PubChem (NCBI)